C11H16O5 — CID 23327723
(1S,3R,9S,10S)-9-methoxy-3-methyl-4,11-dioxabicyclo[8.1.0]undecane-5,7-dione (PubChem CID 23327723) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (1S,3R,9S,10S)-9-methoxy-3-methyl-4,11-dioxabicyclo[8.1.0]undecane-5,7-dione.
| Compound Name | (1S,3R,9S,10S)-9-methoxy-3-methyl-4,11-dioxabicyclo[8.1.0]undecane-5,7-dione |
|---|---|
| PubChem CID | 23327723 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (1S,3R,9S,10S)-9-methoxy-3-methyl-4,11-dioxabicyclo[8.1.0]undecane-5,7-dione |
| SMILES | CO[C@H]1CC(=O)CC(=O)O[C@H](C)C[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C11H16O5/c1-6-3-9-11(16-9)8(14-2)4-7(12)5-10(13)15-6/h6,8-9,11H,3-5H2,1-2H3/t6-,8+,9+,11-/m1/s1 |
| InChIKey | SYWGIHBTDUSGAL-XAWUEOSKSA-N |
| XLogP | 0.45 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|