C22H29N3O2 — CID 23328167
2-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide (PubChem CID 23328167) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide.
| Compound Name | 2-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
|---|---|
| PubChem CID | 23328167 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 2-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)/C(=N/NC(=O)Cc1ccc(N3CCCC3=O)cc1)C2 |
| InChI | InChI=1S/C22H29N3O2/c1-21(2)16-10-11-22(21,3)18(14-16)23-24-19(26)13-15-6-8-17(9-7-15)25-12-4-5-20(25)27/h6-9,16H,4-5,10-14H2,1-3H3,(H,24,26)/b23-18+/t16-,22-/m0/s1 |
| InChIKey | NBJLXJLHVVSFMN-WUTRLJQJSA-N |
| XLogP | 3.67 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|