C17H12ClF3N2O2 — CID 23332695
7-chloro-4-oxido-5-phenyl-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepin-4-ium-2-one (PubChem CID 23332695) has the molecular formula C17H12ClF3N2O2 and a molecular weight of 368.74 g/mol. Its IUPAC name is 7-chloro-4-oxido-5-phenyl-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepin-4-ium-2-one.
| Compound Name | 7-chloro-4-oxido-5-phenyl-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepin-4-ium-2-one |
|---|---|
| PubChem CID | 23332695 |
| Molecular Formula | C17H12ClF3N2O2 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 7-chloro-4-oxido-5-phenyl-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepin-4-ium-2-one |
| SMILES | O=C1C[N+]([O-])=C(c2ccccc2)c2cc(Cl)ccc2N1CC(F)(F)F |
| InChI | InChI=1S/C17H12ClF3N2O2/c18-12-6-7-14-13(8-12)16(11-4-2-1-3-5-11)23(25)9-15(24)22(14)10-17(19,20)21/h1-8H,9-10H2 |
| InChIKey | PJIXKADJKGDJIR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|