About bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane
bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane (PubChem CID 23333432) has the molecular formula C26H44N2O9Si
and a molecular weight of 556.73 g/mol. Its IUPAC name is bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane.
Molecular Properties
| Compound Name | bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane |
| PubChem CID | 23333432 |
| Molecular Formula | C26H44N2O9Si |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane |
| SMILES | O=[Si]([O-])[O-].OCC[N+](CCO)(CCO)Cc1ccccc1.OCC[N+](CCO)(CCO)Cc1ccccc1 |
| InChI | InChI=1S/2C13H22NO3.O3Si/c2*15-9-6-14(7-10-16,8-11-17)12-13-4-2-1-3-5-13;1-4(2)3/h2*1-5,15-17H,6-12H2;/q2*+1;-2 |
| InChIKey | BVRPMZXSJSWLOP-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 184.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane?
The IUPAC name of bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane (CID 23333432) is bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane.
What is the SMILES notation for bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane?
The canonical SMILES for bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane is O=[Si]([O-])[O-].OCC[N+](CCO)(CCO)Cc1ccccc1.OCC[N+](CCO)(CCO)Cc1ccccc1.
What is the InChIKey of bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane?
The InChIKey is BVRPMZXSJSWLOP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H22NO3.O3Si/c2*15-9-6-14(7-10-16,8-11-17)12-13-4-2-1-3-5-13;1-4(2)3/h2*1-5,15-17H,6-12H2;/q2*+1;-2.
What are the key properties of bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane?
bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane has a molecular weight of 556.73 g/mol, XLogP of -2.92, 16 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzyl-tris(2-hydroxyethyl)azanium);dioxido(oxo)silane is sourced from PubChem (CID 23333432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).