About but-2-ynamide;phosphoric acid
but-2-ynamide;phosphoric acid (PubChem CID 23341782) has the molecular formula C4H8NO5P
and a molecular weight of 181.08 g/mol. Its IUPAC name is but-2-ynamide;phosphoric acid.
Molecular Properties
| Compound Name | but-2-ynamide;phosphoric acid |
| PubChem CID | 23341782 |
| Molecular Formula | C4H8NO5P |
| Molecular Weight | 181.08 g/mol |
| Exact Mass | 181.01 |
| IUPAC Name | but-2-ynamide;phosphoric acid |
| SMILES | CC#CC(N)=O.O=P(O)(O)O |
| InChI | InChI=1S/C4H5NO.H3O4P/c1-2-3-4(5)6;1-5(2,3)4/h1H3,(H2,5,6);(H3,1,2,3,4) |
| InChIKey | BITHOWCNERNFMI-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.08 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-ynamide;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ynamide;phosphoric acid?
The IUPAC name of but-2-ynamide;phosphoric acid (CID 23341782) is but-2-ynamide;phosphoric acid.
What is the SMILES notation for but-2-ynamide;phosphoric acid?
The canonical SMILES for but-2-ynamide;phosphoric acid is CC#CC(N)=O.O=P(O)(O)O.
What is the InChIKey of but-2-ynamide;phosphoric acid?
The InChIKey is BITHOWCNERNFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO.H3O4P/c1-2-3-4(5)6;1-5(2,3)4/h1H3,(H2,5,6);(H3,1,2,3,4).
What are the key properties of but-2-ynamide;phosphoric acid?
but-2-ynamide;phosphoric acid has a molecular weight of 181.08 g/mol, XLogP of -1.43, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ynamide;phosphoric acid is sourced from PubChem (CID 23341782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).