About 4-aminobenzoyl bromide;ethanesulfonate
4-aminobenzoyl bromide;ethanesulfonate (PubChem CID 23349406) has the molecular formula C9H11BrNO4S-
and a molecular weight of 309.16 g/mol. Its IUPAC name is 4-aminobenzoyl bromide;ethanesulfonate.
Molecular Properties
| Compound Name | 4-aminobenzoyl bromide;ethanesulfonate |
| PubChem CID | 23349406 |
| Molecular Formula | C9H11BrNO4S- |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 4-aminobenzoyl bromide;ethanesulfonate |
| SMILES | CCS(=O)(=O)[O-].Nc1ccc(C(=O)Br)cc1 |
| InChI | InChI=1S/C7H6BrNO.C2H6O3S/c8-7(10)5-1-3-6(9)4-2-5;1-2-6(3,4)5/h1-4H,9H2;2H2,1H3,(H,3,4,5)/p-1 |
| InChIKey | GSLHAJFFLYFPDB-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzoyl bromide;ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzoyl bromide;ethanesulfonate?
The IUPAC name of 4-aminobenzoyl bromide;ethanesulfonate (CID 23349406) is 4-aminobenzoyl bromide;ethanesulfonate.
What is the SMILES notation for 4-aminobenzoyl bromide;ethanesulfonate?
The canonical SMILES for 4-aminobenzoyl bromide;ethanesulfonate is CCS(=O)(=O)[O-].Nc1ccc(C(=O)Br)cc1.
What is the InChIKey of 4-aminobenzoyl bromide;ethanesulfonate?
The InChIKey is GSLHAJFFLYFPDB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6BrNO.C2H6O3S/c8-7(10)5-1-3-6(9)4-2-5;1-2-6(3,4)5/h1-4H,9H2;2H2,1H3,(H,3,4,5)/p-1.
What are the key properties of 4-aminobenzoyl bromide;ethanesulfonate?
4-aminobenzoyl bromide;ethanesulfonate has a molecular weight of 309.16 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzoyl bromide;ethanesulfonate is sourced from PubChem (CID 23349406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).