C19H22Cl2N2O2 — CID 23349703
3,4-dichloro-N-[2-[furan-2-ylmethyl(methyl)amino]cyclohexyl]benzamide (PubChem CID 23349703) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[furan-2-ylmethyl(methyl)amino]cyclohexyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[furan-2-ylmethyl(methyl)amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 23349703 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3,4-dichloro-N-[2-[furan-2-ylmethyl(methyl)amino]cyclohexyl]benzamide |
| SMILES | CN(Cc1ccco1)C1CCCCC1NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-23(12-14-5-4-10-25-14)18-7-3-2-6-17(18)22-19(24)13-8-9-15(20)16(21)11-13/h4-5,8-11,17-18H,2-3,6-7,12H2,1H3,(H,22,24) |
| InChIKey | LYYHISMSDOPYHU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |