C17H25NO4 — CID 23351447
[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-(2,5-dioxopyrrolidin-1-yl)propanoate (PubChem CID 23351447) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is [(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-(2,5-dioxopyrrolidin-1-yl)propanoate.
| Compound Name | [(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-(2,5-dioxopyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 23351447 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-(2,5-dioxopyrrolidin-1-yl)propanoate |
| SMILES | C[C@H](C(=O)O[C@H]1C[C@H]2CC[C@@]1(C)C2(C)C)N1C(=O)CCC1=O |
| InChI | InChI=1S/C17H25NO4/c1-10(18-13(19)5-6-14(18)20)15(21)22-12-9-11-7-8-17(12,4)16(11,2)3/h10-12H,5-9H2,1-4H3/t10-,11-,12+,17-/m1/s1 |
| InChIKey | CAIWYMGIEAWTLN-YXPOGWMNSA-N |
| XLogP | 2.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|