methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate

C11H18O5 — CID 23352350

IUPACmethyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate
SMILESCOC(=O)CC1CC(CC=O)OC(C)(C)O1
InChIInChI=1S/C11H18O5/c1-11(2)15-8(4-5-12)6-9(16-11)7-10(13)14-3/h5,8-9H,4,6-7H2,1-3H3
InChIKeyMAQGUGHGGYSBIZ-UHFFFAOYSA-N
MW230.26 g/mol
LogP1.05
Rot. Bonds4

About methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate

methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate (PubChem CID 23352350) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate
PubChem CID23352350
Molecular FormulaC11H18O5
Molecular Weight230.26 g/mol
Exact Mass230.12
IUPAC Namemethyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate
SMILESCOC(=O)CC1CC(CC=O)OC(C)(C)O1
InChIInChI=1S/C11H18O5/c1-11(2)15-8(4-5-12)6-9(16-11)7-10(13)14-3/h5,8-9H,4,6-7H2,1-3H3
InChIKeyMAQGUGHGGYSBIZ-UHFFFAOYSA-N
XLogP1.05
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.26
LogP ≤ 51.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate?
The IUPAC name of methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate (CID 23352350) is methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate.
What is the SMILES notation for methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate?
The canonical SMILES for methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate is COC(=O)CC1CC(CC=O)OC(C)(C)O1.
What is the InChIKey of methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate?
The InChIKey is MAQGUGHGGYSBIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O5/c1-11(2)15-8(4-5-12)6-9(16-11)7-10(13)14-3/h5,8-9H,4,6-7H2,1-3H3.
What are the key properties of methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate?
methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate has a molecular weight of 230.26 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate is sourced from PubChem (CID 23352350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).