C13H22O5 — CID 23352411
propyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate (PubChem CID 23352411) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is propyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate.
| Compound Name | propyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 23352411 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | propyl 2-[2,2-dimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]acetate |
| SMILES | CCCOC(=O)CC1CC(CC=O)OC(C)(C)O1 |
| InChI | InChI=1S/C13H22O5/c1-4-7-16-12(15)9-11-8-10(5-6-14)17-13(2,3)18-11/h6,10-11H,4-5,7-9H2,1-3H3 |
| InChIKey | BLOAXZSZNUFWLB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|