C9H4F2N2O3 — CID 23354200
6,8-difluoro-1,5-dihydro-1,5-benzodiazepine-2,3,4-trione (PubChem CID 23354200) has the molecular formula C9H4F2N2O3 and a molecular weight of 226.14 g/mol. Its IUPAC name is 6,8-difluoro-1,5-dihydro-1,5-benzodiazepine-2,3,4-trione.
| Compound Name | 6,8-difluoro-1,5-dihydro-1,5-benzodiazepine-2,3,4-trione |
|---|---|
| PubChem CID | 23354200 |
| Molecular Formula | C9H4F2N2O3 |
| Molecular Weight | 226.14 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 6,8-difluoro-1,5-dihydro-1,5-benzodiazepine-2,3,4-trione |
| SMILES | O=c1[nH]c2cc(F)cc(F)c2[nH]c(=O)c1=O |
| InChI | InChI=1S/C9H4F2N2O3/c10-3-1-4(11)6-5(2-3)12-8(15)7(14)9(16)13-6/h1-2H,(H2,12,13,14,15,16) |
| InChIKey | OCAXFDXIWXMYBI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.14 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|