C10H21F3N2O3S+2 — CID 2335462
2,2,2-trifluoroethyl 2-(4-ethylpiperazine-1,4-diium-1-yl)ethanesulfonate (PubChem CID 2335462) has the molecular formula C10H21F3N2O3S+2 and a molecular weight of 306.35 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-(4-ethylpiperazine-1,4-diium-1-yl)ethanesulfonate.
| Compound Name | 2,2,2-trifluoroethyl 2-(4-ethylpiperazine-1,4-diium-1-yl)ethanesulfonate |
|---|---|
| PubChem CID | 2335462 |
| Molecular Formula | C10H21F3N2O3S+2 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-(4-ethylpiperazine-1,4-diium-1-yl)ethanesulfonate |
| SMILES | CC[NH+]1CC[NH+](CCS(=O)(=O)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H19F3N2O3S/c1-2-14-3-5-15(6-4-14)7-8-19(16,17)18-9-10(11,12)13/h2-9H2,1H3/p+2 |
| InChIKey | UGRSISMRPVQHMJ-UHFFFAOYSA-P |
| XLogP | -2.30 |
| TPSA | 52.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|