C16H13N — CID 23355495
N-naphthalen-2-ylcyclohexa-2,5-dien-1-imine (PubChem CID 23355495) has the molecular formula C16H13N and a molecular weight of 219.29 g/mol. Its IUPAC name is N-naphthalen-2-ylcyclohexa-2,5-dien-1-imine.
| Compound Name | N-naphthalen-2-ylcyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 23355495 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-naphthalen-2-ylcyclohexa-2,5-dien-1-imine |
| SMILES | C1=CC(=Nc2ccc3ccccc3c2)C=CC1 |
| InChI | InChI=1S/C16H13N/c1-2-8-15(9-3-1)17-16-11-10-13-6-4-5-7-14(13)12-16/h2-12H,1H2 |
| InChIKey | OFHAHVKEOSCPRR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|