C19H21N — CID 145265072
N-cyclohepta-1,3,6-trien-1-ylnaphthalen-2-amine;ethane (PubChem CID 145265072) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is N-cyclohepta-1,3,6-trien-1-ylnaphthalen-2-amine;ethane.
| Compound Name | N-cyclohepta-1,3,6-trien-1-ylnaphthalen-2-amine;ethane |
|---|---|
| PubChem CID | 145265072 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-cyclohepta-1,3,6-trien-1-ylnaphthalen-2-amine;ethane |
| SMILES | C1=CCC=CC(Nc2ccc3ccccc3c2)=C1.CC |
| InChI | InChI=1S/C17H15N.C2H6/c1-2-4-10-16(9-3-1)18-17-12-11-14-7-5-6-8-15(14)13-17;1-2/h1,3-13,18H,2H2;1-2H3 |
| InChIKey | YTWJZDYTIFYIQO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |