C19H14 — CID 143380612
tetracyclo[9.8.0.03,9.013,18]nonadeca-1(19),2,4,7,9,11,13,15,17-nonaene (PubChem CID 143380612) has the molecular formula C19H14 and a molecular weight of 242.32 g/mol. Its IUPAC name is tetracyclo[9.8.0.03,9.013,18]nonadeca-1(19),2,4,7,9,11,13,15,17-nonaene.
| Compound Name | tetracyclo[9.8.0.03,9.013,18]nonadeca-1(19),2,4,7,9,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 143380612 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | tetracyclo[9.8.0.03,9.013,18]nonadeca-1(19),2,4,7,9,11,13,15,17-nonaene |
| SMILES | C1=Cc2cc3cc4ccccc4cc3cc2C=CC1 |
| InChI | InChI=1S/C19H14/c1-2-6-14-10-18-12-16-8-4-5-9-17(16)13-19(18)11-15(14)7-3-1/h2-13H,1H2 |
| InChIKey | QRFSZGZYILCOTI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|