About 3-iodo-2-iodylbenzoic acid
3-iodo-2-iodylbenzoic acid (PubChem CID 23356977) has the molecular formula C7H4I2O4
and a molecular weight of 405.91 g/mol. Its IUPAC name is 3-iodo-2-iodylbenzoic acid.
Molecular Properties
| Compound Name | 3-iodo-2-iodylbenzoic acid |
| PubChem CID | 23356977 |
| Molecular Formula | C7H4I2O4 |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.82 |
| IUPAC Name | 3-iodo-2-iodylbenzoic acid |
| SMILES | O=C(O)c1cccc(I)c1I(=O)=O |
| InChI | InChI=1S/C7H4I2O4/c8-5-3-1-2-4(7(10)11)6(5)9(12)13/h1-3H,(H,10,11) |
| InChIKey | WWFWELCGNGLHHO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2-iodylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2-iodylbenzoic acid?
The IUPAC name of 3-iodo-2-iodylbenzoic acid (CID 23356977) is 3-iodo-2-iodylbenzoic acid.
What is the SMILES notation for 3-iodo-2-iodylbenzoic acid?
The canonical SMILES for 3-iodo-2-iodylbenzoic acid is O=C(O)c1cccc(I)c1I(=O)=O.
What is the InChIKey of 3-iodo-2-iodylbenzoic acid?
The InChIKey is WWFWELCGNGLHHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4I2O4/c8-5-3-1-2-4(7(10)11)6(5)9(12)13/h1-3H,(H,10,11).
What are the key properties of 3-iodo-2-iodylbenzoic acid?
3-iodo-2-iodylbenzoic acid has a molecular weight of 405.91 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2-iodylbenzoic acid is sourced from PubChem (CID 23356977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).