About 3-iodo-2-iodosylbenzoic acid
3-iodo-2-iodosylbenzoic acid (PubChem CID 23357360) has the molecular formula C7H4I2O3
and a molecular weight of 389.91 g/mol. Its IUPAC name is 3-iodo-2-iodosylbenzoic acid.
Molecular Properties
| Compound Name | 3-iodo-2-iodosylbenzoic acid |
| PubChem CID | 23357360 |
| Molecular Formula | C7H4I2O3 |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.82 |
| IUPAC Name | 3-iodo-2-iodosylbenzoic acid |
| SMILES | O=Ic1c(I)cccc1C(=O)O |
| InChI | InChI=1S/C7H4I2O3/c8-5-3-1-2-4(7(10)11)6(5)9-12/h1-3H,(H,10,11) |
| InChIKey | YKRNGNLOQANBTF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2-iodosylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2-iodosylbenzoic acid?
The IUPAC name of 3-iodo-2-iodosylbenzoic acid (CID 23357360) is 3-iodo-2-iodosylbenzoic acid.
What is the SMILES notation for 3-iodo-2-iodosylbenzoic acid?
The canonical SMILES for 3-iodo-2-iodosylbenzoic acid is O=Ic1c(I)cccc1C(=O)O.
What is the InChIKey of 3-iodo-2-iodosylbenzoic acid?
The InChIKey is YKRNGNLOQANBTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4I2O3/c8-5-3-1-2-4(7(10)11)6(5)9-12/h1-3H,(H,10,11).
What are the key properties of 3-iodo-2-iodosylbenzoic acid?
3-iodo-2-iodosylbenzoic acid has a molecular weight of 389.91 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2-iodosylbenzoic acid is sourced from PubChem (CID 23357360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).