C6H14O3S — CID 23362546
1-(2-hydroxyethylsulfanyl)butane-2,3-diol (PubChem CID 23362546) has the molecular formula C6H14O3S and a molecular weight of 166.24 g/mol. Its IUPAC name is 1-(2-hydroxyethylsulfanyl)butane-2,3-diol.
| Compound Name | 1-(2-hydroxyethylsulfanyl)butane-2,3-diol |
|---|---|
| PubChem CID | 23362546 |
| Molecular Formula | C6H14O3S |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1-(2-hydroxyethylsulfanyl)butane-2,3-diol |
| SMILES | CC(O)C(O)CSCCO |
| InChI | InChI=1S/C6H14O3S/c1-5(8)6(9)4-10-3-2-7/h5-9H,2-4H2,1H3 |
| InChIKey | USKCETRUTCKNEV-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|