About 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine
2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine (PubChem CID 23363407) has the molecular formula C14H33N3O
and a molecular weight of 259.44 g/mol. Its IUPAC name is 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine.
Molecular Properties
| Compound Name | 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine |
| PubChem CID | 23363407 |
| Molecular Formula | C14H33N3O |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.26 |
| IUPAC Name | 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine |
| SMILES | CCCC(CN(CCC)CCC)C(N)=O.CNC |
| InChI | InChI=1S/C12H26N2O.C2H7N/c1-4-7-11(12(13)15)10-14(8-5-2)9-6-3;1-3-2/h11H,4-10H2,1-3H3,(H2,13,15);3H,1-2H3 |
| InChIKey | HQKWKVCCYFVWOA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine?
The IUPAC name of 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine (CID 23363407) is 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine.
What is the SMILES notation for 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine?
The canonical SMILES for 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine is CCCC(CN(CCC)CCC)C(N)=O.CNC.
What is the InChIKey of 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine?
The InChIKey is HQKWKVCCYFVWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O.C2H7N/c1-4-7-11(12(13)15)10-14(8-5-2)9-6-3;1-3-2/h11H,4-10H2,1-3H3,(H2,13,15);3H,1-2H3.
What are the key properties of 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine?
2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine has a molecular weight of 259.44 g/mol, XLogP of 1.85, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(dipropylamino)methyl]pentanamide;N-methylmethanamine is sourced from PubChem (CID 23363407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).