C31H34N2O7 — CID 23365592
methyl 2-[2-[[4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]phenyl]methyl]pentanoylamino]-3-nitrobenzoate (PubChem CID 23365592) has the molecular formula C31H34N2O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is methyl 2-[2-[[4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]phenyl]methyl]pentanoylamino]-3-nitrobenzoate.
| Compound Name | methyl 2-[2-[[4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]phenyl]methyl]pentanoylamino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 23365592 |
| Molecular Formula | C31H34N2O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | methyl 2-[2-[[4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]phenyl]methyl]pentanoylamino]-3-nitrobenzoate |
| SMILES | CCCC(Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1)C(=O)Nc1c(C(=O)OC)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H34N2O7/c1-6-10-22(28(34)32-27-25(29(35)39-5)13-9-14-26(27)33(37)38)19-20-15-17-21(18-16-20)23-11-7-8-12-24(23)30(36)40-31(2,3)4/h7-9,11-18,22H,6,10,19H2,1-5H3,(H,32,34) |
| InChIKey | NYCTVCPCSFLZAF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|