C23H19NO3 — CID 23366092
N-(2-oxo-1,3-dihydroinden-1-yl)-4-phenylmethoxybenzamide (PubChem CID 23366092) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(2-oxo-1,3-dihydroinden-1-yl)-4-phenylmethoxybenzamide.
| Compound Name | N-(2-oxo-1,3-dihydroinden-1-yl)-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 23366092 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-(2-oxo-1,3-dihydroinden-1-yl)-4-phenylmethoxybenzamide |
| SMILES | O=C(NC1C(=O)Cc2ccccc21)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO3/c25-21-14-18-8-4-5-9-20(18)22(21)24-23(26)17-10-12-19(13-11-17)27-15-16-6-2-1-3-7-16/h1-13,22H,14-15H2,(H,24,26) |
| InChIKey | YBXLUVBBHOJLPU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |