C20H16FNO4S — CID 23371312
methyl 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methoxy]-3-oxo-3-phenylpropanoate (PubChem CID 23371312) has the molecular formula C20H16FNO4S and a molecular weight of 385.42 g/mol. Its IUPAC name is methyl 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methoxy]-3-oxo-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methoxy]-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 23371312 |
| Molecular Formula | C20H16FNO4S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | methyl 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methoxy]-3-oxo-3-phenylpropanoate |
| SMILES | COC(=O)C(OCc1csc(-c2ccc(F)cc2)n1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16FNO4S/c1-25-20(24)18(17(23)13-5-3-2-4-6-13)26-11-16-12-27-19(22-16)14-7-9-15(21)10-8-14/h2-10,12,18H,11H2,1H3 |
| InChIKey | BTLFJQFVWZPUEY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|