C26H25N4O2P — CID 2337274
1-[(R)-dianilinophosphoryl(phenyl)methyl]-3-phenylurea (PubChem CID 2337274) has the molecular formula C26H25N4O2P and a molecular weight of 456.49 g/mol. Its IUPAC name is 1-[(R)-dianilinophosphoryl(phenyl)methyl]-3-phenylurea.
| Compound Name | 1-[(R)-dianilinophosphoryl(phenyl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 2337274 |
| Molecular Formula | C26H25N4O2P |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 1-[(R)-dianilinophosphoryl(phenyl)methyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@@H](c1ccccc1)P(=O)(Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C26H25N4O2P/c31-26(27-22-15-7-2-8-16-22)28-25(21-13-5-1-6-14-21)33(32,29-23-17-9-3-10-18-23)30-24-19-11-4-12-20-24/h1-20,25H,(H2,27,28,31)(H2,29,30,32)/t25-/m1/s1 |
| InChIKey | RRCQRSBSZYOLFS-RUZDIDTESA-N |
| XLogP | 6.92 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|