C20H28F3NO4S — CID 23379590
(E)-3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine (PubChem CID 23379590) has the molecular formula C20H28F3NO4S and a molecular weight of 435.51 g/mol. Its IUPAC name is (E)-3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine.
| Compound Name | (E)-3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine |
|---|---|
| PubChem CID | 23379590 |
| Molecular Formula | C20H28F3NO4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (E)-3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCS(=O)C/C(=N/OC)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C20H28F3NO4S/c1-5-6-9-27-17-12-15(2)19(16(3)13-17)28-10-7-8-11-29(25)14-18(24-26-4)20(21,22)23/h5-6,12-13H,7-11,14H2,1-4H3/b6-5+,24-18- |
| InChIKey | PNDGNPCRAXTGHV-SDMSOHMJSA-N |
| XLogP | 4.73 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|