C21H30F3NO4S — CID 23379597
(E)-3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine (PubChem CID 23379597) has the molecular formula C21H30F3NO4S and a molecular weight of 449.54 g/mol. Its IUPAC name is (E)-3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine.
| Compound Name | (E)-3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine |
|---|---|
| PubChem CID | 23379597 |
| Molecular Formula | C21H30F3NO4S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (E)-3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCS(=O)C/C(=N/OC)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C21H30F3NO4S/c1-5-6-10-28-18-13-16(2)20(17(3)14-18)29-11-8-7-9-12-30(26)15-19(25-27-4)21(22,23)24/h5-6,13-14H,7-12,15H2,1-4H3/b6-5+,25-19- |
| InChIKey | ICETZWVDACIVFL-OUWJYLOCSA-N |
| XLogP | 5.12 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|