C22H32F3NO4S — CID 23379598
(E)-3-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine (PubChem CID 23379598) has the molecular formula C22H32F3NO4S and a molecular weight of 463.56 g/mol. Its IUPAC name is (E)-3-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine.
| Compound Name | (E)-3-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine |
|---|---|
| PubChem CID | 23379598 |
| Molecular Formula | C22H32F3NO4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (E)-3-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexylsulfinyl]-1,1,1-trifluoro-N-methoxypropan-2-imine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCCS(=O)C/C(=N/OC)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C22H32F3NO4S/c1-5-6-11-29-19-14-17(2)21(18(3)15-19)30-12-9-7-8-10-13-31(27)16-20(26-28-4)22(23,24)25/h5-6,14-15H,7-13,16H2,1-4H3/b6-5+,26-20- |
| InChIKey | AHJJECIQIBGMAG-FZYBDWBASA-N |
| XLogP | 5.51 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|