C32H53FN2O8 — CID 23380435
3-acetamido-2-(3-decanoyloxy-2-dec-1-en-2-ylperoxy-1-fluoropropyl)-4-methanimidoyl-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 23380435) has the molecular formula C32H53FN2O8 and a molecular weight of 612.78 g/mol. Its IUPAC name is 3-acetamido-2-(3-decanoyloxy-2-dec-1-en-2-ylperoxy-1-fluoropropyl)-4-methanimidoyl-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 3-acetamido-2-(3-decanoyloxy-2-dec-1-en-2-ylperoxy-1-fluoropropyl)-4-methanimidoyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 23380435 |
| Molecular Formula | C32H53FN2O8 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.38 |
| IUPAC Name | 3-acetamido-2-(3-decanoyloxy-2-dec-1-en-2-ylperoxy-1-fluoropropyl)-4-methanimidoyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | [H]/N=C/C1C=C(C(=O)O)OC(C(F)C(COC(=O)CCCCCCCCC)OOC(=C)CCCCCCCC)C1NC(C)=O |
| InChI | InChI=1S/C32H53FN2O8/c1-5-7-9-11-13-15-17-19-28(37)40-22-27(43-42-23(3)18-16-14-12-10-8-6-2)29(33)31-30(35-24(4)36)25(21-34)20-26(41-31)32(38)39/h20-21,25,27,29-31,34H,3,5-19,22H2,1-2,4H3,(H,35,36)(H,38,39)/b34-21+ |
| InChIKey | PTEMTAAYCAMYKX-KEIPNQJHSA-N |
| XLogP | 6.73 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|