C20H31FN2O7 — CID 23380423
3-acetamido-2-(1-fluoro-2-hydroxy-3-octanoyloxypropyl)-4-methanimidoyl-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 23380423) has the molecular formula C20H31FN2O7 and a molecular weight of 430.47 g/mol. Its IUPAC name is 3-acetamido-2-(1-fluoro-2-hydroxy-3-octanoyloxypropyl)-4-methanimidoyl-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 3-acetamido-2-(1-fluoro-2-hydroxy-3-octanoyloxypropyl)-4-methanimidoyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 23380423 |
| Molecular Formula | C20H31FN2O7 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 3-acetamido-2-(1-fluoro-2-hydroxy-3-octanoyloxypropyl)-4-methanimidoyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | [H]/N=C/C1C=C(C(=O)O)OC(C(F)C(O)COC(=O)CCCCCCC)C1NC(C)=O |
| InChI | InChI=1S/C20H31FN2O7/c1-3-4-5-6-7-8-16(26)29-11-14(25)17(21)19-18(23-12(2)24)13(10-22)9-15(30-19)20(27)28/h9-10,13-14,17-19,22,25H,3-8,11H2,1-2H3,(H,23,24)(H,27,28)/b22-10+ |
| InChIKey | DAEFSQFDZDXCLA-LSHDLFTRSA-N |
| XLogP | 1.73 |
| TPSA | 146.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|