C13H20N4O7W — CID 23380444
4-(diaminomethylideneamino)-2-(1,2-dihydroxy-3-methoxypropyl)-3-(2-oxoethenylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid;tungsten (PubChem CID 23380444) has the molecular formula C13H20N4O7W and a molecular weight of 528.16 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-2-(1,2-dihydroxy-3-methoxypropyl)-3-(2-oxoethenylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid;tungsten.
| Compound Name | 4-(diaminomethylideneamino)-2-(1,2-dihydroxy-3-methoxypropyl)-3-(2-oxoethenylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid;tungsten |
|---|---|
| PubChem CID | 23380444 |
| Molecular Formula | C13H20N4O7W |
| Molecular Weight | 528.16 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 4-(diaminomethylideneamino)-2-(1,2-dihydroxy-3-methoxypropyl)-3-(2-oxoethenylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid;tungsten |
| SMILES | COCC(O)C(O)C1OC(C(=O)O)=CC(N=C(N)N)C1NC=C=O.[W] |
| InChI | InChI=1S/C13H20N4O7.W/c1-23-5-7(19)10(20)11-9(16-2-3-18)6(17-13(14)15)4-8(24-11)12(21)22;/h2,4,6-7,9-11,16,19-20H,5H2,1H3,(H,21,22)(H4,14,15,17); |
| InChIKey | OUIUQVRTMIQNKX-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 189.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.16 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|