C12H13F3N4S2 — CID 23380615
8-(3-prop-2-enylsulfanylpropylsulfanyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 23380615) has the molecular formula C12H13F3N4S2 and a molecular weight of 334.39 g/mol. Its IUPAC name is 8-(3-prop-2-enylsulfanylpropylsulfanyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-(3-prop-2-enylsulfanylpropylsulfanyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 23380615 |
| Molecular Formula | C12H13F3N4S2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 8-(3-prop-2-enylsulfanylpropylsulfanyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | C=CCSCCCSc1nccn2c(C(F)(F)F)nnc12 |
| InChI | InChI=1S/C12H13F3N4S2/c1-2-6-20-7-3-8-21-10-9-17-18-11(12(13,14)15)19(9)5-4-16-10/h2,4-5H,1,3,6-8H2 |
| InChIKey | WFRSEQREZVLWLP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|