About diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate
diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate (PubChem CID 23381831) has the molecular formula C21H23ClO4
and a molecular weight of 374.86 g/mol. Its IUPAC name is diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate |
| PubChem CID | 23381831 |
| Molecular Formula | C21H23ClO4 |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1cc(C)c(-c2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C21H23ClO4/c1-5-25-20(23)19(21(24)26-6-2)18-11-13(3)17(10-14(18)4)15-8-7-9-16(22)12-15/h7-12,19H,5-6H2,1-4H3 |
| InChIKey | WCCOLANPBUGCIK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate?
The IUPAC name of diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate (CID 23381831) is diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate.
What is the SMILES notation for diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate?
The canonical SMILES for diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate is CCOC(=O)C(C(=O)OCC)c1cc(C)c(-c2cccc(Cl)c2)cc1C.
What is the InChIKey of diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate?
The InChIKey is WCCOLANPBUGCIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23ClO4/c1-5-25-20(23)19(21(24)26-6-2)18-11-13(3)17(10-14(18)4)15-8-7-9-16(22)12-15/h7-12,19H,5-6H2,1-4H3.
What are the key properties of diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate?
diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate has a molecular weight of 374.86 g/mol, XLogP of 4.83, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[4-(3-chlorophenyl)-2,5-dimethylphenyl]propanedioate is sourced from PubChem (CID 23381831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).