About methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate
methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate (PubChem CID 23382244) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate.
Analyze methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate?
The IUPAC name of methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate (CID 23382244) is methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate.
What is the SMILES notation for methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate?
The canonical SMILES for methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate is COC(=O)Nc1c(C)c(C)c(C)n(C)c1=O.
What is the InChIKey of methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate?
The InChIKey is AVRIPJWYXLWNCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-6-7(2)9(12-11(15)16-5)10(14)13(4)8(6)3/h1-5H3,(H,12,15).
What are the key properties of methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate?
methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate has a molecular weight of 224.26 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(1,4,5,6-tetramethyl-2-oxo-3-pyridinyl)carbamate is sourced from PubChem (CID 23382244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).