C10H16N2O — CID 22093028
3-amino-1-ethyl-4,5,6-trimethylpyridin-2-one (PubChem CID 22093028) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-amino-1-ethyl-4,5,6-trimethylpyridin-2-one.
| Compound Name | 3-amino-1-ethyl-4,5,6-trimethylpyridin-2-one |
|---|---|
| PubChem CID | 22093028 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-amino-1-ethyl-4,5,6-trimethylpyridin-2-one |
| SMILES | CCn1c(C)c(C)c(C)c(N)c1=O |
| InChI | InChI=1S/C10H16N2O/c1-5-12-8(4)6(2)7(3)9(11)10(12)13/h5,11H2,1-4H3 |
| InChIKey | ZCANYIFPDXHNAN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |