C9H14N2O — CID 23382240
3-amino-1,4,5,6-tetramethylpyridin-2-one (PubChem CID 23382240) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-amino-1,4,5,6-tetramethylpyridin-2-one.
| Compound Name | 3-amino-1,4,5,6-tetramethylpyridin-2-one |
|---|---|
| PubChem CID | 23382240 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-amino-1,4,5,6-tetramethylpyridin-2-one |
| SMILES | Cc1c(C)c(C)n(C)c(=O)c1N |
| InChI | InChI=1S/C9H14N2O/c1-5-6(2)8(10)9(12)11(4)7(5)3/h10H2,1-4H3 |
| InChIKey | TZMKBSUYGCLIBJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |