C8H13N3O — CID 105433487
3,5-diamino-1,4,6-trimethylpyridin-2-one (PubChem CID 105433487) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 3,5-diamino-1,4,6-trimethylpyridin-2-one.
| Compound Name | 3,5-diamino-1,4,6-trimethylpyridin-2-one |
|---|---|
| PubChem CID | 105433487 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3,5-diamino-1,4,6-trimethylpyridin-2-one |
| SMILES | Cc1c(N)c(C)n(C)c(=O)c1N |
| InChI | InChI=1S/C8H13N3O/c1-4-6(9)5(2)11(3)8(12)7(4)10/h9-10H2,1-3H3 |
| InChIKey | UXGFGNJBEVJQOL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |