C20H32ClN3O6 — CID 23382274
4-amino-5-chloro-N-[[(3R,4R)-3-hydroxy-1-(4-oxopentyl)piperidin-4-yl]methyl]-2,3-dimethoxybenzamide;hydrate (PubChem CID 23382274) has the molecular formula C20H32ClN3O6 and a molecular weight of 445.94 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[(3R,4R)-3-hydroxy-1-(4-oxopentyl)piperidin-4-yl]methyl]-2,3-dimethoxybenzamide;hydrate.
| Compound Name | 4-amino-5-chloro-N-[[(3R,4R)-3-hydroxy-1-(4-oxopentyl)piperidin-4-yl]methyl]-2,3-dimethoxybenzamide;hydrate |
|---|---|
| PubChem CID | 23382274 |
| Molecular Formula | C20H32ClN3O6 |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-amino-5-chloro-N-[[(3R,4R)-3-hydroxy-1-(4-oxopentyl)piperidin-4-yl]methyl]-2,3-dimethoxybenzamide;hydrate |
| SMILES | COc1c(C(=O)NCC2CCN(CCCC(C)=O)C[C@@H]2O)cc(Cl)c(N)c1OC.O |
| InChI | InChI=1S/C20H30ClN3O5.H2O/c1-12(25)5-4-7-24-8-6-13(16(26)11-24)10-23-20(27)14-9-15(21)17(22)19(29-3)18(14)28-2;/h9,13,16,26H,4-8,10-11,22H2,1-3H3,(H,23,27);1H2/t13?,16-;/m0./s1 |
| InChIKey | YWHXAABBKQHWNY-GPPWNDLUSA-N |
| XLogP | 0.90 |
| TPSA | 145.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|