C15H20N2O2 — CID 23384012
1-butanoyl-3,5-dimethyl-2-phenylimidazolidin-4-one (PubChem CID 23384012) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-butanoyl-3,5-dimethyl-2-phenylimidazolidin-4-one.
| Compound Name | 1-butanoyl-3,5-dimethyl-2-phenylimidazolidin-4-one |
|---|---|
| PubChem CID | 23384012 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-butanoyl-3,5-dimethyl-2-phenylimidazolidin-4-one |
| SMILES | CCCC(=O)N1C(C)C(=O)N(C)C1c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c1-4-8-13(18)17-11(2)15(19)16(3)14(17)12-9-6-5-7-10-12/h5-7,9-11,14H,4,8H2,1-3H3 |
| InChIKey | XAOLVAPCZGYGGO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |