C11H8N2O3 — CID 23384230
3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 23384230) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23384230 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| SMILES | [C-]#[N+]c1ccc(C2=NOC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C11H8N2O3/c1-12-8-4-2-7(3-5-8)9-6-10(11(14)15)16-13-9/h2-5,10H,6H2,(H,14,15) |
| InChIKey | LWCLIBSTJQEGMG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|