C13H26O — CID 23385033
4-methoxy-5,5-dimethyl-4-propan-2-ylhept-1-ene (PubChem CID 23385033) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is 4-methoxy-5,5-dimethyl-4-propan-2-ylhept-1-ene.
| Compound Name | 4-methoxy-5,5-dimethyl-4-propan-2-ylhept-1-ene |
|---|---|
| PubChem CID | 23385033 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 4-methoxy-5,5-dimethyl-4-propan-2-ylhept-1-ene |
| SMILES | C=CCC(OC)(C(C)C)C(C)(C)CC |
| InChI | InChI=1S/C13H26O/c1-8-10-13(14-7,11(3)4)12(5,6)9-2/h8,11H,1,9-10H2,2-7H3 |
| InChIKey | FZMNNGDKZHUKTK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|