C8H15BrS2 — CID 23389790
2-(bromomethyl)-4-butyl-1,3-dithiolane (PubChem CID 23389790) has the molecular formula C8H15BrS2 and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-(bromomethyl)-4-butyl-1,3-dithiolane.
| Compound Name | 2-(bromomethyl)-4-butyl-1,3-dithiolane |
|---|---|
| PubChem CID | 23389790 |
| Molecular Formula | C8H15BrS2 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 2-(bromomethyl)-4-butyl-1,3-dithiolane |
| SMILES | CCCCC1CSC(CBr)S1 |
| InChI | InChI=1S/C8H15BrS2/c1-2-3-4-7-6-10-8(5-9)11-7/h7-8H,2-6H2,1H3 |
| InChIKey | RCPBTYGHXYMZJA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|