C6H11BrS2 — CID 23389789
2-(bromomethyl)-4,5-dimethyl-1,3-dithiolane (PubChem CID 23389789) has the molecular formula C6H11BrS2 and a molecular weight of 227.19 g/mol. Its IUPAC name is 2-(bromomethyl)-4,5-dimethyl-1,3-dithiolane.
| Compound Name | 2-(bromomethyl)-4,5-dimethyl-1,3-dithiolane |
|---|---|
| PubChem CID | 23389789 |
| Molecular Formula | C6H11BrS2 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 225.95 |
| IUPAC Name | 2-(bromomethyl)-4,5-dimethyl-1,3-dithiolane |
| SMILES | CC1SC(CBr)SC1C |
| InChI | InChI=1S/C6H11BrS2/c1-4-5(2)9-6(3-7)8-4/h4-6H,3H2,1-2H3 |
| InChIKey | RGRVUQCTKABDGE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|