C5H8Br2S2 — CID 86164107
4,5-bis(bromomethyl)-1,3-dithiolane (PubChem CID 86164107) has the molecular formula C5H8Br2S2 and a molecular weight of 292.06 g/mol. Its IUPAC name is 4,5-bis(bromomethyl)-1,3-dithiolane.
| Compound Name | 4,5-bis(bromomethyl)-1,3-dithiolane |
|---|---|
| PubChem CID | 86164107 |
| Molecular Formula | C5H8Br2S2 |
| Molecular Weight | 292.06 g/mol |
| Exact Mass | 289.84 |
| IUPAC Name | 4,5-bis(bromomethyl)-1,3-dithiolane |
| SMILES | BrCC1SCSC1CBr |
| InChI | InChI=1S/C5H8Br2S2/c6-1-4-5(2-7)9-3-8-4/h4-5H,1-3H2 |
| InChIKey | NZGHCMHGOCXQOE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.06 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|