C6H13BrS2 — CID 158583980
2-(bromomethyl)-4-methyl-1,3-dithiolane;methane (PubChem CID 158583980) has the molecular formula C6H13BrS2 and a molecular weight of 229.21 g/mol. Its IUPAC name is 2-(bromomethyl)-4-methyl-1,3-dithiolane;methane.
| Compound Name | 2-(bromomethyl)-4-methyl-1,3-dithiolane;methane |
|---|---|
| PubChem CID | 158583980 |
| Molecular Formula | C6H13BrS2 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 227.96 |
| IUPAC Name | 2-(bromomethyl)-4-methyl-1,3-dithiolane;methane |
| SMILES | C.CC1CSC(CBr)S1 |
| InChI | InChI=1S/C5H9BrS2.CH4/c1-4-3-7-5(2-6)8-4;/h4-5H,2-3H2,1H3;1H4 |
| InChIKey | HTPDNXGWQSZQAA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|