C7H15BrS2 — CID 159593158
2-(bromomethyl)-4,5-dimethyl-1,3-dithiolane;methane (PubChem CID 159593158) has the molecular formula C7H15BrS2 and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-(bromomethyl)-4,5-dimethyl-1,3-dithiolane;methane.
| Compound Name | 2-(bromomethyl)-4,5-dimethyl-1,3-dithiolane;methane |
|---|---|
| PubChem CID | 159593158 |
| Molecular Formula | C7H15BrS2 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 2-(bromomethyl)-4,5-dimethyl-1,3-dithiolane;methane |
| SMILES | C.CC1SC(CBr)SC1C |
| InChI | InChI=1S/C6H11BrS2.CH4/c1-4-5(2)9-6(3-7)8-4;/h4-6H,3H2,1-2H3;1H4 |
| InChIKey | MKMMVJVDDLWIFY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|