C25H37N5O6 — CID 23394844
1,3,5-tris(6-isocyanatohexyl)-1,3-diazinane-2,4,6-trione (PubChem CID 23394844) has the molecular formula C25H37N5O6 and a molecular weight of 503.60 g/mol. Its IUPAC name is 1,3,5-tris(6-isocyanatohexyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(6-isocyanatohexyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23394844 |
| Molecular Formula | C25H37N5O6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 1,3,5-tris(6-isocyanatohexyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C=NCCCCCCC1C(=O)N(CCCCCCN=C=O)C(=O)N(CCCCCCN=C=O)C1=O |
| InChI | InChI=1S/C25H37N5O6/c31-19-26-14-8-2-1-7-13-22-23(34)29(17-11-5-3-9-15-27-20-32)25(36)30(24(22)35)18-12-6-4-10-16-28-21-33/h22H,1-18H2 |
| InChIKey | UKOBDBFAJQSUTD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 145.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|