C24H38N5O5+ — CID 21339210
2-heptyl-7-isocyanato-4-(6-isocyanatohexyl)-2,4-diaza-6-azoniaspiro[5.6]dodecane-1,3,5-trione (PubChem CID 21339210) has the molecular formula C24H38N5O5+ and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-heptyl-7-isocyanato-4-(6-isocyanatohexyl)-2,4-diaza-6-azoniaspiro[5.6]dodecane-1,3,5-trione.
| Compound Name | 2-heptyl-7-isocyanato-4-(6-isocyanatohexyl)-2,4-diaza-6-azoniaspiro[5.6]dodecane-1,3,5-trione |
|---|---|
| PubChem CID | 21339210 |
| Molecular Formula | C24H38N5O5+ |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 2-heptyl-7-isocyanato-4-(6-isocyanatohexyl)-2,4-diaza-6-azoniaspiro[5.6]dodecane-1,3,5-trione |
| SMILES | CCCCCCCN1C(=O)N(CCCCCCN=C=O)C(=O)[N+]2(CCCCCC2N=C=O)C1=O |
| InChI | InChI=1S/C24H38N5O5/c1-2-3-4-6-11-16-27-22(32)28(17-12-7-5-10-15-25-19-30)24(34)29(23(27)33)18-13-8-9-14-21(29)26-20-31/h21H,2-18H2,1H3/q+1 |
| InChIKey | NXOPUXKQORXALL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 116.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|