C22H22N2O6S — CID 2339831
methyl 4-[(Z)-[2-[3-(diethylsulfamoyl)phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate (PubChem CID 2339831) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is methyl 4-[(Z)-[2-[3-(diethylsulfamoyl)phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[2-[3-(diethylsulfamoyl)phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 2339831 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | methyl 4-[(Z)-[2-[3-(diethylsulfamoyl)phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C2=N/C(=C\c3ccc(C(=O)OC)cc3)C(=O)O2)c1 |
| InChI | InChI=1S/C22H22N2O6S/c1-4-24(5-2)31(27,28)18-8-6-7-17(14-18)20-23-19(22(26)30-20)13-15-9-11-16(12-10-15)21(25)29-3/h6-14H,4-5H2,1-3H3/b19-13- |
| InChIKey | ZNIRNOAWCXHJOX-UYRXBGFRSA-N |
| XLogP | 2.85 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|