C16H14F6O6S2Si2 — CID 23399090
[10,10-dimethyl-5-(trifluoromethylsulfonyloxy)silanthren-5-yl] trifluoromethanesulfonate (PubChem CID 23399090) has the molecular formula C16H14F6O6S2Si2 and a molecular weight of 536.58 g/mol. Its IUPAC name is [10,10-dimethyl-5-(trifluoromethylsulfonyloxy)silanthren-5-yl] trifluoromethanesulfonate.
| Compound Name | [10,10-dimethyl-5-(trifluoromethylsulfonyloxy)silanthren-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23399090 |
| Molecular Formula | C16H14F6O6S2Si2 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 535.97 |
| IUPAC Name | [10,10-dimethyl-5-(trifluoromethylsulfonyloxy)silanthren-5-yl] trifluoromethanesulfonate |
| SMILES | C[Si]1(C)c2ccccc2[Si](OS(=O)(=O)C(F)(F)F)(OS(=O)(=O)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C16H14F6O6S2Si2/c1-31(2)11-7-3-5-9-13(11)32(14-10-6-4-8-12(14)31,27-29(23,24)15(17,18)19)28-30(25,26)16(20,21)22/h3-10H,1-2H3 |
| InChIKey | VNAFPOATDVKIBO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|