C26H26N4OS — CID 23401102
5-[1-phenyl-2-(4-phenylpiperidin-1-yl)prop-2-enyl]-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-3-one (PubChem CID 23401102) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is 5-[1-phenyl-2-(4-phenylpiperidin-1-yl)prop-2-enyl]-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-3-one.
| Compound Name | 5-[1-phenyl-2-(4-phenylpiperidin-1-yl)prop-2-enyl]-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-3-one |
|---|---|
| PubChem CID | 23401102 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 5-[1-phenyl-2-(4-phenylpiperidin-1-yl)prop-2-enyl]-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-3-one |
| SMILES | C=C(C(c1ccccc1)n1ccc2[nH][nH]c(=O)c2c1=S)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H26N4OS/c1-18(29-15-12-20(13-16-29)19-8-4-2-5-9-19)24(21-10-6-3-7-11-21)30-17-14-22-23(26(30)32)25(31)28-27-22/h2-11,14,17,20,24H,1,12-13,15-16H2,(H2,27,28,31) |
| InChIKey | NFNUEAAHSJQTJH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 56.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|