C17H36O3 — CID 23404669
2-methoxy-3,5,7,9-tetramethyldodecane-4,8-diol (PubChem CID 23404669) has the molecular formula C17H36O3 and a molecular weight of 288.47 g/mol. Its IUPAC name is 2-methoxy-3,5,7,9-tetramethyldodecane-4,8-diol.
| Compound Name | 2-methoxy-3,5,7,9-tetramethyldodecane-4,8-diol |
|---|---|
| PubChem CID | 23404669 |
| Molecular Formula | C17H36O3 |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.27 |
| IUPAC Name | 2-methoxy-3,5,7,9-tetramethyldodecane-4,8-diol |
| SMILES | CCCC(C)C(O)C(C)CC(C)C(O)C(C)C(C)OC |
| InChI | InChI=1S/C17H36O3/c1-8-9-11(2)16(18)12(3)10-13(4)17(19)14(5)15(6)20-7/h11-19H,8-10H2,1-7H3 |
| InChIKey | NIKDJEQEBDAJCT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |